C24H23Cl2NO2 — CID 126221945
1-[3-chloro-4-[(2-chlorophenyl)methoxy]-5-ethoxyphenyl]-N-(3,4-dimethylphenyl)methanimine (PubChem CID 126221945) has the molecular formula C24H23Cl2NO2 and a molecular weight of 428.36 g/mol. Its IUPAC name is 1-[3-chloro-4-[(2-chlorophenyl)methoxy]-5-ethoxyphenyl]-N-(3,4-dimethylphenyl)methanimine.
| Compound Name | 1-[3-chloro-4-[(2-chlorophenyl)methoxy]-5-ethoxyphenyl]-N-(3,4-dimethylphenyl)methanimine |
|---|---|
| PubChem CID | 126221945 |
| Molecular Formula | C24H23Cl2NO2 |
| Molecular Weight | 428.36 g/mol |
| Exact Mass | 427.11 |
| IUPAC Name | 1-[3-chloro-4-[(2-chlorophenyl)methoxy]-5-ethoxyphenyl]-N-(3,4-dimethylphenyl)methanimine |
| SMILES | CCOc1cc(/C=N/c2ccc(C)c(C)c2)cc(Cl)c1OCc1ccccc1Cl |
| InChI | InChI=1S/C24H23Cl2NO2/c1-4-28-23-13-18(14-27-20-10-9-16(2)17(3)11-20)12-22(26)24(23)29-15-19-7-5-6-8-21(19)25/h5-14H,4,15H2,1-3H3/b27-14+ |
| InChIKey | DYDDOXJXBVGMEL-MZJWZYIUSA-N |
| XLogP | 7.34 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.36 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|