C23H22ClNO2 — CID 126218007
1-(3-chloro-5-methoxy-4-phenylmethoxyphenyl)-N-(3,4-dimethylphenyl)methanimine (PubChem CID 126218007) has the molecular formula C23H22ClNO2 and a molecular weight of 379.89 g/mol. Its IUPAC name is 1-(3-chloro-5-methoxy-4-phenylmethoxyphenyl)-N-(3,4-dimethylphenyl)methanimine.
| Compound Name | 1-(3-chloro-5-methoxy-4-phenylmethoxyphenyl)-N-(3,4-dimethylphenyl)methanimine |
|---|---|
| PubChem CID | 126218007 |
| Molecular Formula | C23H22ClNO2 |
| Molecular Weight | 379.89 g/mol |
| Exact Mass | 379.13 |
| IUPAC Name | 1-(3-chloro-5-methoxy-4-phenylmethoxyphenyl)-N-(3,4-dimethylphenyl)methanimine |
| SMILES | COc1cc(/C=N/c2ccc(C)c(C)c2)cc(Cl)c1OCc1ccccc1 |
| InChI | InChI=1S/C23H22ClNO2/c1-16-9-10-20(11-17(16)2)25-14-19-12-21(24)23(22(13-19)26-3)27-15-18-7-5-4-6-8-18/h4-14H,15H2,1-3H3/b25-14+ |
| InChIKey | NCAMSOGGHJTJPF-AFUMVMLFSA-N |
| XLogP | 6.30 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.89 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|