C22H19ClINO2 — CID 126221318
N-(3-chloro-2-methylphenyl)-1-(3-iodo-5-methoxy-4-phenylmethoxyphenyl)methanimine (PubChem CID 126221318) has the molecular formula C22H19ClINO2 and a molecular weight of 491.76 g/mol. Its IUPAC name is N-(3-chloro-2-methylphenyl)-1-(3-iodo-5-methoxy-4-phenylmethoxyphenyl)methanimine.
| Compound Name | N-(3-chloro-2-methylphenyl)-1-(3-iodo-5-methoxy-4-phenylmethoxyphenyl)methanimine |
|---|---|
| PubChem CID | 126221318 |
| Molecular Formula | C22H19ClINO2 |
| Molecular Weight | 491.76 g/mol |
| Exact Mass | 491.01 |
| IUPAC Name | N-(3-chloro-2-methylphenyl)-1-(3-iodo-5-methoxy-4-phenylmethoxyphenyl)methanimine |
| SMILES | COc1cc(/C=N/c2cccc(Cl)c2C)cc(I)c1OCc1ccccc1 |
| InChI | InChI=1S/C22H19ClINO2/c1-15-18(23)9-6-10-20(15)25-13-17-11-19(24)22(21(12-17)26-2)27-14-16-7-4-3-5-8-16/h3-13H,14H2,1-2H3/b25-13+ |
| InChIKey | ZYWXSRYYCSFNKT-DHRITJCHSA-N |
| XLogP | 6.59 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.76 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|