C18H17ClINO4 — CID 126208645
2-[4-[(3-chloro-2-methylphenyl)iminomethyl]-2-ethoxy-6-iodophenoxy]acetic acid (PubChem CID 126208645) has the molecular formula C18H17ClINO4 and a molecular weight of 473.69 g/mol. Its IUPAC name is 2-[4-[(3-chloro-2-methylphenyl)iminomethyl]-2-ethoxy-6-iodophenoxy]acetic acid.
| Compound Name | 2-[4-[(3-chloro-2-methylphenyl)iminomethyl]-2-ethoxy-6-iodophenoxy]acetic acid |
|---|---|
| PubChem CID | 126208645 |
| Molecular Formula | C18H17ClINO4 |
| Molecular Weight | 473.69 g/mol |
| Exact Mass | 472.99 |
| IUPAC Name | 2-[4-[(3-chloro-2-methylphenyl)iminomethyl]-2-ethoxy-6-iodophenoxy]acetic acid |
| SMILES | CCOc1cc(/C=N/c2cccc(Cl)c2C)cc(I)c1OCC(=O)O |
| InChI | InChI=1S/C18H17ClINO4/c1-3-24-16-8-12(7-14(20)18(16)25-10-17(22)23)9-21-15-6-4-5-13(19)11(15)2/h4-9H,3,10H2,1-2H3,(H,22,23)/b21-9+ |
| InChIKey | QLICIYYKXLTDDJ-ZVBGSRNCSA-N |
| XLogP | 4.87 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.69 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|