C18H18INO4 — CID 126206250
2-[4-[(2,5-dimethylphenyl)iminomethyl]-2-iodo-6-methoxyphenoxy]acetic acid (PubChem CID 126206250) has the molecular formula C18H18INO4 and a molecular weight of 439.25 g/mol. Its IUPAC name is 2-[4-[(2,5-dimethylphenyl)iminomethyl]-2-iodo-6-methoxyphenoxy]acetic acid.
| Compound Name | 2-[4-[(2,5-dimethylphenyl)iminomethyl]-2-iodo-6-methoxyphenoxy]acetic acid |
|---|---|
| PubChem CID | 126206250 |
| Molecular Formula | C18H18INO4 |
| Molecular Weight | 439.25 g/mol |
| Exact Mass | 439.03 |
| IUPAC Name | 2-[4-[(2,5-dimethylphenyl)iminomethyl]-2-iodo-6-methoxyphenoxy]acetic acid |
| SMILES | COc1cc(/C=N/c2cc(C)ccc2C)cc(I)c1OCC(=O)O |
| InChI | InChI=1S/C18H18INO4/c1-11-4-5-12(2)15(6-11)20-9-13-7-14(19)18(16(8-13)23-3)24-10-17(21)22/h4-9H,10H2,1-3H3,(H,21,22)/b20-9+ |
| InChIKey | FNCYZRUHSSCNOP-AWQFTUOYSA-N |
| XLogP | 4.13 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.25 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|