C12H11IN4O4 — CID 21381427
2-[2-iodo-6-methoxy-4-[(Z)-1,2,4-triazol-4-yliminomethyl]phenoxy]acetic acid (PubChem CID 21381427) has the molecular formula C12H11IN4O4 and a molecular weight of 402.15 g/mol. Its IUPAC name is 2-[2-iodo-6-methoxy-4-[(Z)-1,2,4-triazol-4-yliminomethyl]phenoxy]acetic acid.
| Compound Name | 2-[2-iodo-6-methoxy-4-[(Z)-1,2,4-triazol-4-yliminomethyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 21381427 |
| Molecular Formula | C12H11IN4O4 |
| Molecular Weight | 402.15 g/mol |
| Exact Mass | 401.98 |
| IUPAC Name | 2-[2-iodo-6-methoxy-4-[(Z)-1,2,4-triazol-4-yliminomethyl]phenoxy]acetic acid |
| SMILES | COc1cc(/C=N\n2cnnc2)cc(I)c1OCC(=O)O |
| InChI | InChI=1S/C12H11IN4O4/c1-20-10-3-8(4-16-17-6-14-15-7-17)2-9(13)12(10)21-5-11(18)19/h2-4,6-7H,5H2,1H3,(H,18,19)/b16-4- |
| InChIKey | XGSIGXQNLRSEFZ-XRVIQIRUSA-N |
| XLogP | 1.24 |
| TPSA | 98.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.15 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|