C15H15IO8 — CID 126066077
2-[2-iodo-6-methoxy-4-(3-methoxy-2-methoxycarbonyl-3-oxoprop-1-enyl)phenoxy]acetic acid (PubChem CID 126066077) has the molecular formula C15H15IO8 and a molecular weight of 450.18 g/mol. Its IUPAC name is 2-[2-iodo-6-methoxy-4-(3-methoxy-2-methoxycarbonyl-3-oxoprop-1-enyl)phenoxy]acetic acid.
| Compound Name | 2-[2-iodo-6-methoxy-4-(3-methoxy-2-methoxycarbonyl-3-oxoprop-1-enyl)phenoxy]acetic acid |
|---|---|
| PubChem CID | 126066077 |
| Molecular Formula | C15H15IO8 |
| Molecular Weight | 450.18 g/mol |
| Exact Mass | 449.98 |
| IUPAC Name | 2-[2-iodo-6-methoxy-4-(3-methoxy-2-methoxycarbonyl-3-oxoprop-1-enyl)phenoxy]acetic acid |
| SMILES | COC(=O)C(=Cc1cc(I)c(OCC(=O)O)c(OC)c1)C(=O)OC |
| InChI | InChI=1S/C15H15IO8/c1-21-11-6-8(4-9(14(19)22-2)15(20)23-3)5-10(16)13(11)24-7-12(17)18/h4-6H,7H2,1-3H3,(H,17,18) |
| InChIKey | WWZCYRFHCGWWAD-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.18 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|