2-(4-formyl-2,6-diiodophenoxy)acetic acid

C9H6I2O4 — CID 4763783

IUPAC2-(4-formyl-2,6-diiodophenoxy)acetic acid
SMILESO=Cc1cc(I)c(OCC(=O)O)c(I)c1
InChIInChI=1S/C9H6I2O4/c10-6-1-5(3-12)2-7(11)9(6)15-4-8(13)14/h1-3H,4H2,(H,13,14)
InChIKeyJSFQBZAJDFMNII-UHFFFAOYSA-N
MW431.95 g/mol
LogP2.17
Rot. Bonds4

About 2-(4-formyl-2,6-diiodophenoxy)acetic acid

2-(4-formyl-2,6-diiodophenoxy)acetic acid (PubChem CID 4763783) has the molecular formula C9H6I2O4 and a molecular weight of 431.95 g/mol. Its IUPAC name is 2-(4-formyl-2,6-diiodophenoxy)acetic acid.

Molecular Properties

Compound Name2-(4-formyl-2,6-diiodophenoxy)acetic acid
PubChem CID4763783
Molecular FormulaC9H6I2O4
Molecular Weight431.95 g/mol
Exact Mass431.84
IUPAC Name2-(4-formyl-2,6-diiodophenoxy)acetic acid
SMILESO=Cc1cc(I)c(OCC(=O)O)c(I)c1
InChIInChI=1S/C9H6I2O4/c10-6-1-5(3-12)2-7(11)9(6)15-4-8(13)14/h1-3H,4H2,(H,13,14)
InChIKeyJSFQBZAJDFMNII-UHFFFAOYSA-N
XLogP2.17
TPSA63.60 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500431.95
LogP ≤ 52.17
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}

Analyze 2-(4-formyl-2,6-diiodophenoxy)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(4-formyl-2,6-diiodophenoxy)acetic acid?
The IUPAC name of 2-(4-formyl-2,6-diiodophenoxy)acetic acid (CID 4763783) is 2-(4-formyl-2,6-diiodophenoxy)acetic acid.
What is the SMILES notation for 2-(4-formyl-2,6-diiodophenoxy)acetic acid?
The canonical SMILES for 2-(4-formyl-2,6-diiodophenoxy)acetic acid is O=Cc1cc(I)c(OCC(=O)O)c(I)c1.
What is the InChIKey of 2-(4-formyl-2,6-diiodophenoxy)acetic acid?
The InChIKey is JSFQBZAJDFMNII-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6I2O4/c10-6-1-5(3-12)2-7(11)9(6)15-4-8(13)14/h1-3H,4H2,(H,13,14).
What are the key properties of 2-(4-formyl-2,6-diiodophenoxy)acetic acid?
2-(4-formyl-2,6-diiodophenoxy)acetic acid has a molecular weight of 431.95 g/mol, XLogP of 2.17, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-formyl-2,6-diiodophenoxy)acetic acid is sourced from PubChem (CID 4763783), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).