C16H13I2NO7S — CID 126078907
2-[2,6-diiodo-4-[(E)-[3-[(2S)-1-methoxy-1-oxopropan-2-yl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetic acid (PubChem CID 126078907) has the molecular formula C16H13I2NO7S and a molecular weight of 617.16 g/mol. Its IUPAC name is 2-[2,6-diiodo-4-[(E)-[3-[(2S)-1-methoxy-1-oxopropan-2-yl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetic acid.
| Compound Name | 2-[2,6-diiodo-4-[(E)-[3-[(2S)-1-methoxy-1-oxopropan-2-yl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 126078907 |
| Molecular Formula | C16H13I2NO7S |
| Molecular Weight | 617.16 g/mol |
| Exact Mass | 616.85 |
| IUPAC Name | 2-[2,6-diiodo-4-[(E)-[3-[(2S)-1-methoxy-1-oxopropan-2-yl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetic acid |
| SMILES | COC(=O)[C@H](C)N1C(=O)S/C(=C/c2cc(I)c(OCC(=O)O)c(I)c2)C1=O |
| InChI | InChI=1S/C16H13I2NO7S/c1-7(15(23)25-2)19-14(22)11(27-16(19)24)5-8-3-9(17)13(10(18)4-8)26-6-12(20)21/h3-5,7H,6H2,1-2H3,(H,20,21)/b11-5+/t7-/m0/s1 |
| InChIKey | VUXOOXSASSLHAL-AUEGDVLESA-N |
| XLogP | 2.96 |
| TPSA | 110.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.16 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_B(16)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|