C18H17I2NO5S — CID 126017282
ethyl (2S)-2-[(5E)-5-[(3,5-diiodo-4-prop-2-enoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]propanoate (PubChem CID 126017282) has the molecular formula C18H17I2NO5S and a molecular weight of 613.21 g/mol. Its IUPAC name is ethyl (2S)-2-[(5E)-5-[(3,5-diiodo-4-prop-2-enoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]propanoate.
| Compound Name | ethyl (2S)-2-[(5E)-5-[(3,5-diiodo-4-prop-2-enoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]propanoate |
|---|---|
| PubChem CID | 126017282 |
| Molecular Formula | C18H17I2NO5S |
| Molecular Weight | 613.21 g/mol |
| Exact Mass | 612.89 |
| IUPAC Name | ethyl (2S)-2-[(5E)-5-[(3,5-diiodo-4-prop-2-enoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]propanoate |
| SMILES | C=CCOc1c(I)cc(/C=C2/SC(=O)N([C@@H](C)C(=O)OCC)C2=O)cc1I |
| InChI | InChI=1S/C18H17I2NO5S/c1-4-6-26-15-12(19)7-11(8-13(15)20)9-14-16(22)21(18(24)27-14)10(3)17(23)25-5-2/h4,7-10H,1,5-6H2,2-3H3/b14-9+/t10-/m0/s1 |
| InChIKey | DBGBTROKOQGFIR-RSYJBZMQSA-N |
| XLogP | 4.45 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.21 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_B(16)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|