C23H19I2NO7S — CID 126027458
4-[[4-[(E)-[3-[(2R)-1-ethoxy-1-oxopropan-2-yl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2,6-diiodophenoxy]methyl]benzoic acid (PubChem CID 126027458) has the molecular formula C23H19I2NO7S and a molecular weight of 707.28 g/mol. Its IUPAC name is 4-[[4-[(E)-[3-[(2R)-1-ethoxy-1-oxopropan-2-yl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2,6-diiodophenoxy]methyl]benzoic acid.
| Compound Name | 4-[[4-[(E)-[3-[(2R)-1-ethoxy-1-oxopropan-2-yl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2,6-diiodophenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 126027458 |
| Molecular Formula | C23H19I2NO7S |
| Molecular Weight | 707.28 g/mol |
| Exact Mass | 706.90 |
| IUPAC Name | 4-[[4-[(E)-[3-[(2R)-1-ethoxy-1-oxopropan-2-yl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2,6-diiodophenoxy]methyl]benzoic acid |
| SMILES | CCOC(=O)[C@@H](C)N1C(=O)S/C(=C/c2cc(I)c(OCc3ccc(C(=O)O)cc3)c(I)c2)C1=O |
| InChI | InChI=1S/C23H19I2NO7S/c1-3-32-22(30)12(2)26-20(27)18(34-23(26)31)10-14-8-16(24)19(17(25)9-14)33-11-13-4-6-15(7-5-13)21(28)29/h4-10,12H,3,11H2,1-2H3,(H,28,29)/b18-10+/t12-/m1/s1 |
| InChIKey | UZMJWPYZSUMPTL-SGEFVQMOSA-N |
| XLogP | 5.16 |
| TPSA | 110.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.28 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_B(16)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|