C25H24INO8S — CID 126017873
3-[[2-ethoxy-4-[(E)-[3-[(2S)-1-ethoxy-1-oxopropan-2-yl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-6-iodophenoxy]methyl]benzoic acid (PubChem CID 126017873) has the molecular formula C25H24INO8S and a molecular weight of 625.44 g/mol. Its IUPAC name is 3-[[2-ethoxy-4-[(E)-[3-[(2S)-1-ethoxy-1-oxopropan-2-yl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-6-iodophenoxy]methyl]benzoic acid.
| Compound Name | 3-[[2-ethoxy-4-[(E)-[3-[(2S)-1-ethoxy-1-oxopropan-2-yl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-6-iodophenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 126017873 |
| Molecular Formula | C25H24INO8S |
| Molecular Weight | 625.44 g/mol |
| Exact Mass | 625.03 |
| IUPAC Name | 3-[[2-ethoxy-4-[(E)-[3-[(2S)-1-ethoxy-1-oxopropan-2-yl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-6-iodophenoxy]methyl]benzoic acid |
| SMILES | CCOC(=O)[C@H](C)N1C(=O)S/C(=C/c2cc(I)c(OCc3cccc(C(=O)O)c3)c(OCC)c2)C1=O |
| InChI | InChI=1S/C25H24INO8S/c1-4-33-19-11-16(12-20-22(28)27(25(32)36-20)14(3)24(31)34-5-2)10-18(26)21(19)35-13-15-7-6-8-17(9-15)23(29)30/h6-12,14H,4-5,13H2,1-3H3,(H,29,30)/b20-12+/t14-/m0/s1 |
| InChIKey | GVWMNNUMGASLHC-PVGUKEHMSA-N |
| XLogP | 4.95 |
| TPSA | 119.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.44 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|