C27H27IN2O7S — CID 126390967
3-[[4-[(Z)-[2,4-dioxo-3-(2-oxo-2-piperidin-1-ylethyl)-1,3-thiazolidin-5-ylidene]methyl]-2-ethoxy-6-iodophenoxy]methyl]benzoic acid (PubChem CID 126390967) has the molecular formula C27H27IN2O7S and a molecular weight of 650.49 g/mol. Its IUPAC name is 3-[[4-[(Z)-[2,4-dioxo-3-(2-oxo-2-piperidin-1-ylethyl)-1,3-thiazolidin-5-ylidene]methyl]-2-ethoxy-6-iodophenoxy]methyl]benzoic acid.
| Compound Name | 3-[[4-[(Z)-[2,4-dioxo-3-(2-oxo-2-piperidin-1-ylethyl)-1,3-thiazolidin-5-ylidene]methyl]-2-ethoxy-6-iodophenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 126390967 |
| Molecular Formula | C27H27IN2O7S |
| Molecular Weight | 650.49 g/mol |
| Exact Mass | 650.06 |
| IUPAC Name | 3-[[4-[(Z)-[2,4-dioxo-3-(2-oxo-2-piperidin-1-ylethyl)-1,3-thiazolidin-5-ylidene]methyl]-2-ethoxy-6-iodophenoxy]methyl]benzoic acid |
| SMILES | CCOc1cc(/C=C2\SC(=O)N(CC(=O)N3CCCCC3)C2=O)cc(I)c1OCc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C27H27IN2O7S/c1-2-36-21-13-18(12-20(28)24(21)37-16-17-7-6-8-19(11-17)26(33)34)14-22-25(32)30(27(35)38-22)15-23(31)29-9-4-3-5-10-29/h6-8,11-14H,2-5,9-10,15-16H2,1H3,(H,33,34)/b22-14- |
| InChIKey | NIFIDRSRGVCNMH-HMAPJEAMSA-N |
| XLogP | 5.02 |
| TPSA | 113.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.49 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|