C27H28IN3O7S — CID 3997722
3-[2-(azepan-1-yl)-2-oxoethyl]-5-[[3-ethoxy-5-iodo-4-[(3-nitrophenyl)methoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 3997722) has the molecular formula C27H28IN3O7S and a molecular weight of 665.51 g/mol. Its IUPAC name is 3-[2-(azepan-1-yl)-2-oxoethyl]-5-[[3-ethoxy-5-iodo-4-[(3-nitrophenyl)methoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | 3-[2-(azepan-1-yl)-2-oxoethyl]-5-[[3-ethoxy-5-iodo-4-[(3-nitrophenyl)methoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 3997722 |
| Molecular Formula | C27H28IN3O7S |
| Molecular Weight | 665.51 g/mol |
| Exact Mass | 665.07 |
| IUPAC Name | 3-[2-(azepan-1-yl)-2-oxoethyl]-5-[[3-ethoxy-5-iodo-4-[(3-nitrophenyl)methoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | CCOc1cc(C=C2SC(=O)N(CC(=O)N3CCCCCC3)C2=O)cc(I)c1OCc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C27H28IN3O7S/c1-2-37-22-14-19(13-21(28)25(22)38-17-18-8-7-9-20(12-18)31(35)36)15-23-26(33)30(27(34)39-23)16-24(32)29-10-5-3-4-6-11-29/h7-9,12-15H,2-6,10-11,16-17H2,1H3 |
| InChIKey | GYYMCAVMYZYHSJ-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 119.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.51 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|