C25H25IN2O6S — CID 124664131
(5E)-5-[(3-ethoxy-5-iodo-4-phenylmethoxyphenyl)methylidene]-3-(2-morpholin-4-yl-2-oxoethyl)-1,3-thiazolidine-2,4-dione (PubChem CID 124664131) has the molecular formula C25H25IN2O6S and a molecular weight of 608.45 g/mol. Its IUPAC name is (5E)-5-[(3-ethoxy-5-iodo-4-phenylmethoxyphenyl)methylidene]-3-(2-morpholin-4-yl-2-oxoethyl)-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[(3-ethoxy-5-iodo-4-phenylmethoxyphenyl)methylidene]-3-(2-morpholin-4-yl-2-oxoethyl)-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 124664131 |
| Molecular Formula | C25H25IN2O6S |
| Molecular Weight | 608.45 g/mol |
| Exact Mass | 608.05 |
| IUPAC Name | (5E)-5-[(3-ethoxy-5-iodo-4-phenylmethoxyphenyl)methylidene]-3-(2-morpholin-4-yl-2-oxoethyl)-1,3-thiazolidine-2,4-dione |
| SMILES | CCOc1cc(/C=C2/SC(=O)N(CC(=O)N3CCOCC3)C2=O)cc(I)c1OCc1ccccc1 |
| InChI | InChI=1S/C25H25IN2O6S/c1-2-33-20-13-18(12-19(26)23(20)34-16-17-6-4-3-5-7-17)14-21-24(30)28(25(31)35-21)15-22(29)27-8-10-32-11-9-27/h3-7,12-14H,2,8-11,15-16H2,1H3/b21-14+ |
| InChIKey | PGKGCWOANURYCO-KGENOOAVSA-N |
| XLogP | 4.16 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.45 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|