C29H27IN2O6S — CID 126139265
(5E)-5-[[3-ethoxy-5-iodo-4-(naphthalen-2-ylmethoxy)phenyl]methylidene]-3-(2-morpholin-4-yl-2-oxoethyl)-1,3-thiazolidine-2,4-dione (PubChem CID 126139265) has the molecular formula C29H27IN2O6S and a molecular weight of 658.51 g/mol. Its IUPAC name is (5E)-5-[[3-ethoxy-5-iodo-4-(naphthalen-2-ylmethoxy)phenyl]methylidene]-3-(2-morpholin-4-yl-2-oxoethyl)-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[[3-ethoxy-5-iodo-4-(naphthalen-2-ylmethoxy)phenyl]methylidene]-3-(2-morpholin-4-yl-2-oxoethyl)-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126139265 |
| Molecular Formula | C29H27IN2O6S |
| Molecular Weight | 658.51 g/mol |
| Exact Mass | 658.06 |
| IUPAC Name | (5E)-5-[[3-ethoxy-5-iodo-4-(naphthalen-2-ylmethoxy)phenyl]methylidene]-3-(2-morpholin-4-yl-2-oxoethyl)-1,3-thiazolidine-2,4-dione |
| SMILES | CCOc1cc(/C=C2/SC(=O)N(CC(=O)N3CCOCC3)C2=O)cc(I)c1OCc1ccc2ccccc2c1 |
| InChI | InChI=1S/C29H27IN2O6S/c1-2-37-24-15-20(14-23(30)27(24)38-18-19-7-8-21-5-3-4-6-22(21)13-19)16-25-28(34)32(29(35)39-25)17-26(33)31-9-11-36-12-10-31/h3-8,13-16H,2,9-12,17-18H2,1H3/b25-16+ |
| InChIKey | YUHSKTXCMCQBQH-PCLIKHOPSA-N |
| XLogP | 5.32 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.51 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|