C26H25ClN2O8S — CID 126137878
4-[[2-chloro-6-ethoxy-4-[(E)-[3-(2-morpholin-4-yl-2-oxoethyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]methyl]benzoic acid (PubChem CID 126137878) has the molecular formula C26H25ClN2O8S and a molecular weight of 561.01 g/mol. Its IUPAC name is 4-[[2-chloro-6-ethoxy-4-[(E)-[3-(2-morpholin-4-yl-2-oxoethyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]methyl]benzoic acid.
| Compound Name | 4-[[2-chloro-6-ethoxy-4-[(E)-[3-(2-morpholin-4-yl-2-oxoethyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 126137878 |
| Molecular Formula | C26H25ClN2O8S |
| Molecular Weight | 561.01 g/mol |
| Exact Mass | 560.10 |
| IUPAC Name | 4-[[2-chloro-6-ethoxy-4-[(E)-[3-(2-morpholin-4-yl-2-oxoethyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]methyl]benzoic acid |
| SMILES | CCOc1cc(/C=C2/SC(=O)N(CC(=O)N3CCOCC3)C2=O)cc(Cl)c1OCc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C26H25ClN2O8S/c1-2-36-20-12-17(11-19(27)23(20)37-15-16-3-5-18(6-4-16)25(32)33)13-21-24(31)29(26(34)38-21)14-22(30)28-7-9-35-10-8-28/h3-6,11-13H,2,7-10,14-15H2,1H3,(H,32,33)/b21-13+ |
| InChIKey | IYQZPWFJIRFEOH-FYJGNVAPSA-N |
| XLogP | 3.91 |
| TPSA | 122.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.01 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|