C23H19BrCl2N2O5S — CID 126129190
(5E)-5-[[4-[(4-bromophenyl)methoxy]-3,5-dichlorophenyl]methylidene]-3-(2-morpholin-4-yl-2-oxoethyl)-1,3-thiazolidine-2,4-dione (PubChem CID 126129190) has the molecular formula C23H19BrCl2N2O5S and a molecular weight of 586.29 g/mol. Its IUPAC name is (5E)-5-[[4-[(4-bromophenyl)methoxy]-3,5-dichlorophenyl]methylidene]-3-(2-morpholin-4-yl-2-oxoethyl)-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[[4-[(4-bromophenyl)methoxy]-3,5-dichlorophenyl]methylidene]-3-(2-morpholin-4-yl-2-oxoethyl)-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126129190 |
| Molecular Formula | C23H19BrCl2N2O5S |
| Molecular Weight | 586.29 g/mol |
| Exact Mass | 583.96 |
| IUPAC Name | (5E)-5-[[4-[(4-bromophenyl)methoxy]-3,5-dichlorophenyl]methylidene]-3-(2-morpholin-4-yl-2-oxoethyl)-1,3-thiazolidine-2,4-dione |
| SMILES | O=C(CN1C(=O)S/C(=C/c2cc(Cl)c(OCc3ccc(Br)cc3)c(Cl)c2)C1=O)N1CCOCC1 |
| InChI | InChI=1S/C23H19BrCl2N2O5S/c24-16-3-1-14(2-4-16)13-33-21-17(25)9-15(10-18(21)26)11-19-22(30)28(23(31)34-19)12-20(29)27-5-7-32-8-6-27/h1-4,9-11H,5-8,12-13H2/b19-11+ |
| InChIKey | CRPTYPXZPKSHST-YBFXNURJSA-N |
| XLogP | 5.23 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.29 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_B(16)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|