C25H24Cl2N2O4S — CID 126374953
(5Z)-5-[[3,5-dichloro-4-[(4-methylphenyl)methoxy]phenyl]methylidene]-3-(2-oxo-2-piperidin-1-ylethyl)-1,3-thiazolidine-2,4-dione (PubChem CID 126374953) has the molecular formula C25H24Cl2N2O4S and a molecular weight of 519.45 g/mol. Its IUPAC name is (5Z)-5-[[3,5-dichloro-4-[(4-methylphenyl)methoxy]phenyl]methylidene]-3-(2-oxo-2-piperidin-1-ylethyl)-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[3,5-dichloro-4-[(4-methylphenyl)methoxy]phenyl]methylidene]-3-(2-oxo-2-piperidin-1-ylethyl)-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126374953 |
| Molecular Formula | C25H24Cl2N2O4S |
| Molecular Weight | 519.45 g/mol |
| Exact Mass | 518.08 |
| IUPAC Name | (5Z)-5-[[3,5-dichloro-4-[(4-methylphenyl)methoxy]phenyl]methylidene]-3-(2-oxo-2-piperidin-1-ylethyl)-1,3-thiazolidine-2,4-dione |
| SMILES | Cc1ccc(COc2c(Cl)cc(/C=C3\SC(=O)N(CC(=O)N4CCCCC4)C3=O)cc2Cl)cc1 |
| InChI | InChI=1S/C25H24Cl2N2O4S/c1-16-5-7-17(8-6-16)15-33-23-19(26)11-18(12-20(23)27)13-21-24(31)29(25(32)34-21)14-22(30)28-9-3-2-4-10-28/h5-8,11-13H,2-4,9-10,14-15H2,1H3/b21-13- |
| InChIKey | OUBRPPLXOYFLSM-BKUYFWCQSA-N |
| XLogP | 5.93 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.45 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_B(16)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|