C19H18Cl2N2O6S — CID 5210527
2-[2,6-dichloro-4-[[2,4-dioxo-3-(2-oxo-2-piperidin-1-ylethyl)-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetic acid (PubChem CID 5210527) has the molecular formula C19H18Cl2N2O6S and a molecular weight of 473.33 g/mol. Its IUPAC name is 2-[2,6-dichloro-4-[[2,4-dioxo-3-(2-oxo-2-piperidin-1-ylethyl)-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetic acid.
| Compound Name | 2-[2,6-dichloro-4-[[2,4-dioxo-3-(2-oxo-2-piperidin-1-ylethyl)-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 5210527 |
| Molecular Formula | C19H18Cl2N2O6S |
| Molecular Weight | 473.33 g/mol |
| Exact Mass | 472.03 |
| IUPAC Name | 2-[2,6-dichloro-4-[[2,4-dioxo-3-(2-oxo-2-piperidin-1-ylethyl)-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetic acid |
| SMILES | O=C(O)COc1c(Cl)cc(C=C2SC(=O)N(CC(=O)N3CCCCC3)C2=O)cc1Cl |
| InChI | InChI=1S/C19H18Cl2N2O6S/c20-12-6-11(7-13(21)17(12)29-10-16(25)26)8-14-18(27)23(19(28)30-14)9-15(24)22-4-2-1-3-5-22/h6-8H,1-5,9-10H2,(H,25,26) |
| InChIKey | CURRSVNNULSBNI-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 104.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.33 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_B(16)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|