C23H25ClN2O5S — CID 3538026
3-[2-(azepan-1-yl)-2-oxoethyl]-5-[(3-chloro-5-ethoxy-4-prop-2-ynoxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 3538026) has the molecular formula C23H25ClN2O5S and a molecular weight of 476.98 g/mol. Its IUPAC name is 3-[2-(azepan-1-yl)-2-oxoethyl]-5-[(3-chloro-5-ethoxy-4-prop-2-ynoxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | 3-[2-(azepan-1-yl)-2-oxoethyl]-5-[(3-chloro-5-ethoxy-4-prop-2-ynoxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 3538026 |
| Molecular Formula | C23H25ClN2O5S |
| Molecular Weight | 476.98 g/mol |
| Exact Mass | 476.12 |
| IUPAC Name | 3-[2-(azepan-1-yl)-2-oxoethyl]-5-[(3-chloro-5-ethoxy-4-prop-2-ynoxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | C#CCOc1c(Cl)cc(C=C2SC(=O)N(CC(=O)N3CCCCCC3)C2=O)cc1OCC |
| InChI | InChI=1S/C23H25ClN2O5S/c1-3-11-31-21-17(24)12-16(13-18(21)30-4-2)14-19-22(28)26(23(29)32-19)15-20(27)25-9-7-5-6-8-10-25/h1,12-14H,4-11,15H2,2H3 |
| InChIKey | HQIIMYMBVYAALT-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.98 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|