C23H27ClN2O7S — CID 5042220
ethyl 2-[4-[[3-[2-(azepan-1-yl)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2-chloro-6-methoxyphenoxy]acetate (PubChem CID 5042220) has the molecular formula C23H27ClN2O7S and a molecular weight of 511.00 g/mol. Its IUPAC name is ethyl 2-[4-[[3-[2-(azepan-1-yl)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2-chloro-6-methoxyphenoxy]acetate.
| Compound Name | ethyl 2-[4-[[3-[2-(azepan-1-yl)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2-chloro-6-methoxyphenoxy]acetate |
|---|---|
| PubChem CID | 5042220 |
| Molecular Formula | C23H27ClN2O7S |
| Molecular Weight | 511.00 g/mol |
| Exact Mass | 510.12 |
| IUPAC Name | ethyl 2-[4-[[3-[2-(azepan-1-yl)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2-chloro-6-methoxyphenoxy]acetate |
| SMILES | CCOC(=O)COc1c(Cl)cc(C=C2SC(=O)N(CC(=O)N3CCCCCC3)C2=O)cc1OC |
| InChI | InChI=1S/C23H27ClN2O7S/c1-3-32-20(28)14-33-21-16(24)10-15(11-17(21)31-2)12-18-22(29)26(23(30)34-18)13-19(27)25-8-6-4-5-7-9-25/h10-12H,3-9,13-14H2,1-2H3 |
| InChIKey | JQNOWIUQVZIGAF-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 102.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.00 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|