C20H20Br2N2O6S — CID 126387084
methyl 2-[2,6-dibromo-4-[(Z)-[2,4-dioxo-3-(2-oxo-2-piperidin-1-ylethyl)-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetate (PubChem CID 126387084) has the molecular formula C20H20Br2N2O6S and a molecular weight of 576.26 g/mol. Its IUPAC name is methyl 2-[2,6-dibromo-4-[(Z)-[2,4-dioxo-3-(2-oxo-2-piperidin-1-ylethyl)-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetate.
| Compound Name | methyl 2-[2,6-dibromo-4-[(Z)-[2,4-dioxo-3-(2-oxo-2-piperidin-1-ylethyl)-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 126387084 |
| Molecular Formula | C20H20Br2N2O6S |
| Molecular Weight | 576.26 g/mol |
| Exact Mass | 573.94 |
| IUPAC Name | methyl 2-[2,6-dibromo-4-[(Z)-[2,4-dioxo-3-(2-oxo-2-piperidin-1-ylethyl)-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetate |
| SMILES | COC(=O)COc1c(Br)cc(/C=C2\SC(=O)N(CC(=O)N3CCCCC3)C2=O)cc1Br |
| InChI | InChI=1S/C20H20Br2N2O6S/c1-29-17(26)11-30-18-13(21)7-12(8-14(18)22)9-15-19(27)24(20(28)31-15)10-16(25)23-5-3-2-4-6-23/h7-9H,2-6,10-11H2,1H3/b15-9- |
| InChIKey | NZGWCQNQZULGPN-DHDCSXOGSA-N |
| XLogP | 3.81 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.26 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_B(16)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|