C25H23Br2N3O6S — CID 126025260
methyl 2-[2,6-dibromo-4-[(E)-[2,4-dioxo-3-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetate (PubChem CID 126025260) has the molecular formula C25H23Br2N3O6S and a molecular weight of 653.35 g/mol. Its IUPAC name is methyl 2-[2,6-dibromo-4-[(E)-[2,4-dioxo-3-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetate.
| Compound Name | methyl 2-[2,6-dibromo-4-[(E)-[2,4-dioxo-3-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 126025260 |
| Molecular Formula | C25H23Br2N3O6S |
| Molecular Weight | 653.35 g/mol |
| Exact Mass | 650.97 |
| IUPAC Name | methyl 2-[2,6-dibromo-4-[(E)-[2,4-dioxo-3-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetate |
| SMILES | COC(=O)COc1c(Br)cc(/C=C2/SC(=O)N(CC(=O)N3CCN(c4ccccc4)CC3)C2=O)cc1Br |
| InChI | InChI=1S/C25H23Br2N3O6S/c1-35-22(32)15-36-23-18(26)11-16(12-19(23)27)13-20-24(33)30(25(34)37-20)14-21(31)29-9-7-28(8-10-29)17-5-3-2-4-6-17/h2-6,11-13H,7-10,14-15H2,1H3/b20-13+ |
| InChIKey | IBALOYWZEZTVPO-DEDYPNTBSA-N |
| XLogP | 4.15 |
| TPSA | 96.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.35 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_B(16)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|