C24H23Br2N3O4S — CID 126027238
(5E)-5-[(3,5-dibromo-4-ethoxyphenyl)methylidene]-3-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]-1,3-thiazolidine-2,4-dione (PubChem CID 126027238) has the molecular formula C24H23Br2N3O4S and a molecular weight of 609.34 g/mol. Its IUPAC name is (5E)-5-[(3,5-dibromo-4-ethoxyphenyl)methylidene]-3-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[(3,5-dibromo-4-ethoxyphenyl)methylidene]-3-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126027238 |
| Molecular Formula | C24H23Br2N3O4S |
| Molecular Weight | 609.34 g/mol |
| Exact Mass | 606.98 |
| IUPAC Name | (5E)-5-[(3,5-dibromo-4-ethoxyphenyl)methylidene]-3-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]-1,3-thiazolidine-2,4-dione |
| SMILES | CCOc1c(Br)cc(/C=C2/SC(=O)N(CC(=O)N3CCN(c4ccccc4)CC3)C2=O)cc1Br |
| InChI | InChI=1S/C24H23Br2N3O4S/c1-2-33-22-18(25)12-16(13-19(22)26)14-20-23(31)29(24(32)34-20)15-21(30)28-10-8-27(9-11-28)17-6-4-3-5-7-17/h3-7,12-14H,2,8-11,15H2,1H3/b20-14+ |
| InChIKey | RQXAJEIGJOBKKB-XSFVSMFZSA-N |
| XLogP | 5.00 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.34 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_B(16)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|