C16H15Br2NO5S — CID 124641383
ethyl 2-[(5E)-5-[(3,5-dibromo-4-ethoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate (PubChem CID 124641383) has the molecular formula C16H15Br2NO5S and a molecular weight of 493.17 g/mol. Its IUPAC name is ethyl 2-[(5E)-5-[(3,5-dibromo-4-ethoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate.
| Compound Name | ethyl 2-[(5E)-5-[(3,5-dibromo-4-ethoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate |
|---|---|
| PubChem CID | 124641383 |
| Molecular Formula | C16H15Br2NO5S |
| Molecular Weight | 493.17 g/mol |
| Exact Mass | 490.90 |
| IUPAC Name | ethyl 2-[(5E)-5-[(3,5-dibromo-4-ethoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate |
| SMILES | CCOC(=O)CN1C(=O)S/C(=C/c2cc(Br)c(OCC)c(Br)c2)C1=O |
| InChI | InChI=1S/C16H15Br2NO5S/c1-3-23-13(20)8-19-15(21)12(25-16(19)22)7-9-5-10(17)14(24-4-2)11(18)6-9/h5-7H,3-4,8H2,1-2H3/b12-7+ |
| InChIKey | XUIDTXQMLUMYRU-KPKJPENVSA-N |
| XLogP | 4.21 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.17 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_B(16)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|