C25H19Br2NO5S — CID 124641010
ethyl 2-[(5E)-5-[[3,5-dibromo-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate (PubChem CID 124641010) has the molecular formula C25H19Br2NO5S and a molecular weight of 605.30 g/mol. Its IUPAC name is ethyl 2-[(5E)-5-[[3,5-dibromo-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate.
| Compound Name | ethyl 2-[(5E)-5-[[3,5-dibromo-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate |
|---|---|
| PubChem CID | 124641010 |
| Molecular Formula | C25H19Br2NO5S |
| Molecular Weight | 605.30 g/mol |
| Exact Mass | 602.94 |
| IUPAC Name | ethyl 2-[(5E)-5-[[3,5-dibromo-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate |
| SMILES | CCOC(=O)CN1C(=O)S/C(=C/c2cc(Br)c(OCc3cccc4ccccc34)c(Br)c2)C1=O |
| InChI | InChI=1S/C25H19Br2NO5S/c1-2-32-22(29)13-28-24(30)21(34-25(28)31)12-15-10-19(26)23(20(27)11-15)33-14-17-8-5-7-16-6-3-4-9-18(16)17/h3-12H,2,13-14H2,1H3/b21-12+ |
| InChIKey | PYIOJQKOKMMAHZ-CIAFOILYSA-N |
| XLogP | 6.54 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.30 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_B(16)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|