C23H16BrNO5S — CID 126147013
2-[(5E)-5-[[3-bromo-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetic acid (PubChem CID 126147013) has the molecular formula C23H16BrNO5S and a molecular weight of 498.35 g/mol. Its IUPAC name is 2-[(5E)-5-[[3-bromo-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetic acid.
| Compound Name | 2-[(5E)-5-[[3-bromo-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 126147013 |
| Molecular Formula | C23H16BrNO5S |
| Molecular Weight | 498.35 g/mol |
| Exact Mass | 496.99 |
| IUPAC Name | 2-[(5E)-5-[[3-bromo-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetic acid |
| SMILES | O=C(O)CN1C(=O)S/C(=C/c2ccc(OCc3cccc4ccccc34)c(Br)c2)C1=O |
| InChI | InChI=1S/C23H16BrNO5S/c24-18-10-14(11-20-22(28)25(12-21(26)27)23(29)31-20)8-9-19(18)30-13-16-6-3-5-15-4-1-2-7-17(15)16/h1-11H,12-13H2,(H,26,27)/b20-11+ |
| InChIKey | SARUFDDCGFPVKR-RGVLZGJSSA-N |
| XLogP | 5.30 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.35 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|