C30H22BrNO5S — CID 4644045
3-[2-(4-bromophenyl)-2-oxoethyl]-5-[[3-methoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 4644045) has the molecular formula C30H22BrNO5S and a molecular weight of 588.48 g/mol. Its IUPAC name is 3-[2-(4-bromophenyl)-2-oxoethyl]-5-[[3-methoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | 3-[2-(4-bromophenyl)-2-oxoethyl]-5-[[3-methoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 4644045 |
| Molecular Formula | C30H22BrNO5S |
| Molecular Weight | 588.48 g/mol |
| Exact Mass | 587.04 |
| IUPAC Name | 3-[2-(4-bromophenyl)-2-oxoethyl]-5-[[3-methoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | COc1cc(C=C2SC(=O)N(CC(=O)c3ccc(Br)cc3)C2=O)ccc1OCc1cccc2ccccc12 |
| InChI | InChI=1S/C30H22BrNO5S/c1-36-27-15-19(9-14-26(27)37-18-22-7-4-6-20-5-2-3-8-24(20)22)16-28-29(34)32(30(35)38-28)17-25(33)21-10-12-23(31)13-11-21/h2-16H,17-18H2,1H3 |
| InChIKey | WPZVZIHXZHGUCE-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.48 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|