C31H23BrINO5S — CID 126226309
(5E)-3-[2-(4-bromophenyl)-2-oxoethyl]-5-[[3-ethoxy-5-iodo-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 126226309) has the molecular formula C31H23BrINO5S and a molecular weight of 728.40 g/mol. Its IUPAC name is (5E)-3-[2-(4-bromophenyl)-2-oxoethyl]-5-[[3-ethoxy-5-iodo-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-3-[2-(4-bromophenyl)-2-oxoethyl]-5-[[3-ethoxy-5-iodo-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126226309 |
| Molecular Formula | C31H23BrINO5S |
| Molecular Weight | 728.40 g/mol |
| Exact Mass | 726.95 |
| IUPAC Name | (5E)-3-[2-(4-bromophenyl)-2-oxoethyl]-5-[[3-ethoxy-5-iodo-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | CCOc1cc(/C=C2/SC(=O)N(CC(=O)c3ccc(Br)cc3)C2=O)cc(I)c1OCc1cccc2ccccc12 |
| InChI | InChI=1S/C31H23BrINO5S/c1-2-38-27-15-19(14-25(33)29(27)39-18-22-8-5-7-20-6-3-4-9-24(20)22)16-28-30(36)34(31(37)40-28)17-26(35)21-10-12-23(32)13-11-21/h3-16H,2,17-18H2,1H3/b28-16+ |
| InChIKey | UJYCGCQVBPMVSQ-LQKURTRISA-N |
| XLogP | 8.10 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.40 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|