C27H24INO6S — CID 124641628
ethyl 2-[(5E)-5-[[3-ethoxy-5-iodo-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate (PubChem CID 124641628) has the molecular formula C27H24INO6S and a molecular weight of 617.46 g/mol. Its IUPAC name is ethyl 2-[(5E)-5-[[3-ethoxy-5-iodo-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate.
| Compound Name | ethyl 2-[(5E)-5-[[3-ethoxy-5-iodo-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate |
|---|---|
| PubChem CID | 124641628 |
| Molecular Formula | C27H24INO6S |
| Molecular Weight | 617.46 g/mol |
| Exact Mass | 617.04 |
| IUPAC Name | ethyl 2-[(5E)-5-[[3-ethoxy-5-iodo-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate |
| SMILES | CCOC(=O)CN1C(=O)S/C(=C/c2cc(I)c(OCc3cccc4ccccc34)c(OCC)c2)C1=O |
| InChI | InChI=1S/C27H24INO6S/c1-3-33-22-13-17(14-23-26(31)29(27(32)36-23)15-24(30)34-4-2)12-21(28)25(22)35-16-19-10-7-9-18-8-5-6-11-20(18)19/h5-14H,3-4,15-16H2,1-2H3/b23-14+ |
| InChIKey | WXINFZSQGFBQLO-OEAKJJBVSA-N |
| XLogP | 6.02 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.46 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|