C31H23ClINO6S — CID 124668217
(5E)-3-[(6-chloro-1,3-benzodioxol-5-yl)methyl]-5-[[3-ethoxy-5-iodo-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 124668217) has the molecular formula C31H23ClINO6S and a molecular weight of 699.95 g/mol. Its IUPAC name is (5E)-3-[(6-chloro-1,3-benzodioxol-5-yl)methyl]-5-[[3-ethoxy-5-iodo-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-3-[(6-chloro-1,3-benzodioxol-5-yl)methyl]-5-[[3-ethoxy-5-iodo-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 124668217 |
| Molecular Formula | C31H23ClINO6S |
| Molecular Weight | 699.95 g/mol |
| Exact Mass | 699.00 |
| IUPAC Name | (5E)-3-[(6-chloro-1,3-benzodioxol-5-yl)methyl]-5-[[3-ethoxy-5-iodo-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | CCOc1cc(/C=C2/SC(=O)N(Cc3cc4c(cc3Cl)OCO4)C2=O)cc(I)c1OCc1cccc2ccccc12 |
| InChI | InChI=1S/C31H23ClINO6S/c1-2-37-27-11-18(10-24(33)29(27)38-16-20-8-5-7-19-6-3-4-9-22(19)20)12-28-30(35)34(31(36)41-28)15-21-13-25-26(14-23(21)32)40-17-39-25/h3-14H,2,15-17H2,1H3/b28-12+ |
| InChIKey | KZOVWSCKIZTDBT-KVSWJAHQSA-N |
| XLogP | 8.04 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.95 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|