C37H31NO4S — CID 21377120
(5E)-5-[[3-ethoxy-4-(naphthalen-1-ylmethoxy)-5-prop-2-enylphenyl]methylidene]-3-(naphthalen-1-ylmethyl)-1,3-thiazolidine-2,4-dione (PubChem CID 21377120) has the molecular formula C37H31NO4S and a molecular weight of 585.73 g/mol. Its IUPAC name is (5E)-5-[[3-ethoxy-4-(naphthalen-1-ylmethoxy)-5-prop-2-enylphenyl]methylidene]-3-(naphthalen-1-ylmethyl)-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[[3-ethoxy-4-(naphthalen-1-ylmethoxy)-5-prop-2-enylphenyl]methylidene]-3-(naphthalen-1-ylmethyl)-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 21377120 |
| Molecular Formula | C37H31NO4S |
| Molecular Weight | 585.73 g/mol |
| Exact Mass | 585.20 |
| IUPAC Name | (5E)-5-[[3-ethoxy-4-(naphthalen-1-ylmethoxy)-5-prop-2-enylphenyl]methylidene]-3-(naphthalen-1-ylmethyl)-1,3-thiazolidine-2,4-dione |
| SMILES | C=CCc1cc(/C=C2/SC(=O)N(Cc3cccc4ccccc34)C2=O)cc(OCC)c1OCc1cccc2ccccc12 |
| InChI | InChI=1S/C37H31NO4S/c1-3-11-28-20-25(21-33(41-4-2)35(28)42-24-30-17-10-15-27-13-6-8-19-32(27)30)22-34-36(39)38(37(40)43-34)23-29-16-9-14-26-12-5-7-18-31(26)29/h3,5-10,12-22H,1,4,11,23-24H2,2H3/b34-22+ |
| InChIKey | MEYZGIXXSHSBPQ-PPOKSSTKSA-N |
| XLogP | 8.94 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.73 |
| LogP ≤ 5 | 8.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|