C32H26ClNO4S — CID 126208098
(5E)-3-(3-chlorophenyl)-5-[[3-ethoxy-4-(naphthalen-1-ylmethoxy)-5-prop-2-enylphenyl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 126208098) has the molecular formula C32H26ClNO4S and a molecular weight of 556.08 g/mol. Its IUPAC name is (5E)-3-(3-chlorophenyl)-5-[[3-ethoxy-4-(naphthalen-1-ylmethoxy)-5-prop-2-enylphenyl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-3-(3-chlorophenyl)-5-[[3-ethoxy-4-(naphthalen-1-ylmethoxy)-5-prop-2-enylphenyl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126208098 |
| Molecular Formula | C32H26ClNO4S |
| Molecular Weight | 556.08 g/mol |
| Exact Mass | 555.13 |
| IUPAC Name | (5E)-3-(3-chlorophenyl)-5-[[3-ethoxy-4-(naphthalen-1-ylmethoxy)-5-prop-2-enylphenyl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | C=CCc1cc(/C=C2/SC(=O)N(c3cccc(Cl)c3)C2=O)cc(OCC)c1OCc1cccc2ccccc12 |
| InChI | InChI=1S/C32H26ClNO4S/c1-3-9-23-16-21(18-29-31(35)34(32(36)39-29)26-14-8-13-25(33)19-26)17-28(37-4-2)30(23)38-20-24-12-7-11-22-10-5-6-15-27(22)24/h3,5-8,10-19H,1,4,9,20H2,2H3/b29-18+ |
| InChIKey | OLHKTJJANKGKMR-RDRPBHBLSA-N |
| XLogP | 8.44 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.08 |
| LogP ≤ 5 | 8.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|