C29H27NO3S2 — CID 126355988
(5E)-5-[(3-ethoxy-4-phenylmethoxy-5-prop-2-enylphenyl)methylidene]-3-(3-methylphenyl)-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 126355988) has the molecular formula C29H27NO3S2 and a molecular weight of 501.67 g/mol. Its IUPAC name is (5E)-5-[(3-ethoxy-4-phenylmethoxy-5-prop-2-enylphenyl)methylidene]-3-(3-methylphenyl)-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-[(3-ethoxy-4-phenylmethoxy-5-prop-2-enylphenyl)methylidene]-3-(3-methylphenyl)-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126355988 |
| Molecular Formula | C29H27NO3S2 |
| Molecular Weight | 501.67 g/mol |
| Exact Mass | 501.14 |
| IUPAC Name | (5E)-5-[(3-ethoxy-4-phenylmethoxy-5-prop-2-enylphenyl)methylidene]-3-(3-methylphenyl)-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | C=CCc1cc(/C=C2/SC(=S)N(c3cccc(C)c3)C2=O)cc(OCC)c1OCc1ccccc1 |
| InChI | InChI=1S/C29H27NO3S2/c1-4-10-23-16-22(17-25(32-5-2)27(23)33-19-21-12-7-6-8-13-21)18-26-28(31)30(29(34)35-26)24-14-9-11-20(3)15-24/h4,6-9,11-18H,1,5,10,19H2,2-3H3/b26-18+ |
| InChIKey | QXLQRBMHCUNONP-NLRVBDNBSA-N |
| XLogP | 7.11 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.67 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|