C22H18NO5S2- — CID 54682514
4-[(E)-[3-(3-carboxyphenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-2-ethoxy-6-prop-2-enylphenolate (PubChem CID 54682514) has the molecular formula C22H18NO5S2- and a molecular weight of 440.52 g/mol. Its IUPAC name is 4-[(E)-[3-(3-carboxyphenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-2-ethoxy-6-prop-2-enylphenolate.
| Compound Name | 4-[(E)-[3-(3-carboxyphenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-2-ethoxy-6-prop-2-enylphenolate |
|---|---|
| PubChem CID | 54682514 |
| Molecular Formula | C22H18NO5S2- |
| Molecular Weight | 440.52 g/mol |
| Exact Mass | 440.06 |
| IUPAC Name | 4-[(E)-[3-(3-carboxyphenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-2-ethoxy-6-prop-2-enylphenolate |
| SMILES | C=CCc1cc(/C=C2/SC(=S)N(c3cccc(C(=O)O)c3)C2=O)cc(OCC)c1[O-] |
| InChI | InChI=1S/C22H19NO5S2/c1-3-6-14-9-13(10-17(19(14)24)28-4-2)11-18-20(25)23(22(29)30-18)16-8-5-7-15(12-16)21(26)27/h3,5,7-12,24H,1,4,6H2,2H3,(H,26,27)/p-1/b18-11+ |
| InChIKey | ITDDQRQPOTYRBB-WOJGMQOQSA-M |
| XLogP | 3.99 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.52 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|