C29H26ClNO4S2 — CID 126335844
(5Z)-3-(3-chloro-4-methoxyphenyl)-5-[(3-ethoxy-4-phenylmethoxy-5-prop-2-enylphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 126335844) has the molecular formula C29H26ClNO4S2 and a molecular weight of 552.12 g/mol. Its IUPAC name is (5Z)-3-(3-chloro-4-methoxyphenyl)-5-[(3-ethoxy-4-phenylmethoxy-5-prop-2-enylphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-3-(3-chloro-4-methoxyphenyl)-5-[(3-ethoxy-4-phenylmethoxy-5-prop-2-enylphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126335844 |
| Molecular Formula | C29H26ClNO4S2 |
| Molecular Weight | 552.12 g/mol |
| Exact Mass | 551.10 |
| IUPAC Name | (5Z)-3-(3-chloro-4-methoxyphenyl)-5-[(3-ethoxy-4-phenylmethoxy-5-prop-2-enylphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | C=CCc1cc(/C=C2\SC(=S)N(c3ccc(OC)c(Cl)c3)C2=O)cc(OCC)c1OCc1ccccc1 |
| InChI | InChI=1S/C29H26ClNO4S2/c1-4-9-21-14-20(15-25(34-5-2)27(21)35-18-19-10-7-6-8-11-19)16-26-28(32)31(29(36)37-26)22-12-13-24(33-3)23(30)17-22/h4,6-8,10-17H,1,5,9,18H2,2-3H3/b26-16- |
| InChIKey | HPDXTBKLJIKSDC-QQXSKIMKSA-N |
| XLogP | 7.46 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.12 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|