C27H22BrNO3S2 — CID 126201535
(5Z)-3-(3-bromophenyl)-5-[(3-methoxy-4-phenylmethoxy-5-prop-2-enylphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 126201535) has the molecular formula C27H22BrNO3S2 and a molecular weight of 552.52 g/mol. Its IUPAC name is (5Z)-3-(3-bromophenyl)-5-[(3-methoxy-4-phenylmethoxy-5-prop-2-enylphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-3-(3-bromophenyl)-5-[(3-methoxy-4-phenylmethoxy-5-prop-2-enylphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126201535 |
| Molecular Formula | C27H22BrNO3S2 |
| Molecular Weight | 552.52 g/mol |
| Exact Mass | 551.02 |
| IUPAC Name | (5Z)-3-(3-bromophenyl)-5-[(3-methoxy-4-phenylmethoxy-5-prop-2-enylphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | C=CCc1cc(/C=C2\SC(=S)N(c3cccc(Br)c3)C2=O)cc(OC)c1OCc1ccccc1 |
| InChI | InChI=1S/C27H22BrNO3S2/c1-3-8-20-13-19(14-23(31-2)25(20)32-17-18-9-5-4-6-10-18)15-24-26(30)29(27(33)34-24)22-12-7-11-21(28)16-22/h3-7,9-16H,1,8,17H2,2H3/b24-15- |
| InChIKey | HIEGYMMLZBWZLQ-IWIPYMOSSA-N |
| XLogP | 7.17 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.52 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|