C22H21NO3S3 — CID 126344202
(5Z)-5-[(3,4-dimethoxy-5-prop-2-enylphenyl)methylidene]-3-(3-methylsulfanylphenyl)-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 126344202) has the molecular formula C22H21NO3S3 and a molecular weight of 443.62 g/mol. Its IUPAC name is (5Z)-5-[(3,4-dimethoxy-5-prop-2-enylphenyl)methylidene]-3-(3-methylsulfanylphenyl)-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[(3,4-dimethoxy-5-prop-2-enylphenyl)methylidene]-3-(3-methylsulfanylphenyl)-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126344202 |
| Molecular Formula | C22H21NO3S3 |
| Molecular Weight | 443.62 g/mol |
| Exact Mass | 443.07 |
| IUPAC Name | (5Z)-5-[(3,4-dimethoxy-5-prop-2-enylphenyl)methylidene]-3-(3-methylsulfanylphenyl)-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | C=CCc1cc(/C=C2\SC(=S)N(c3cccc(SC)c3)C2=O)cc(OC)c1OC |
| InChI | InChI=1S/C22H21NO3S3/c1-5-7-15-10-14(11-18(25-2)20(15)26-3)12-19-21(24)23(22(27)29-19)16-8-6-9-17(13-16)28-4/h5-6,8-13H,1,7H2,2-4H3/b19-12- |
| InChIKey | CJGKQXGXJKHZPQ-UNOMPAQXSA-N |
| XLogP | 5.56 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.62 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|