C18H14BrNO3S3 — CID 126344731
(5E)-5-[(3-bromo-4-hydroxy-5-methoxyphenyl)methylidene]-3-(3-methylsulfanylphenyl)-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 126344731) has the molecular formula C18H14BrNO3S3 and a molecular weight of 468.42 g/mol. Its IUPAC name is (5E)-5-[(3-bromo-4-hydroxy-5-methoxyphenyl)methylidene]-3-(3-methylsulfanylphenyl)-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-[(3-bromo-4-hydroxy-5-methoxyphenyl)methylidene]-3-(3-methylsulfanylphenyl)-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126344731 |
| Molecular Formula | C18H14BrNO3S3 |
| Molecular Weight | 468.42 g/mol |
| Exact Mass | 466.93 |
| IUPAC Name | (5E)-5-[(3-bromo-4-hydroxy-5-methoxyphenyl)methylidene]-3-(3-methylsulfanylphenyl)-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | COc1cc(/C=C2/SC(=S)N(c3cccc(SC)c3)C2=O)cc(Br)c1O |
| InChI | InChI=1S/C18H14BrNO3S3/c1-23-14-7-10(6-13(19)16(14)21)8-15-17(22)20(18(24)26-15)11-4-3-5-12(9-11)25-2/h3-9,21H,1-2H3/b15-8+ |
| InChIKey | MSKIENNGNLAFDD-OVCLIPMQSA-N |
| XLogP | 5.29 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.42 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|