C20H16BrNO5S2 — CID 19174569
ethyl 3-[(5E)-5-[(3-bromo-4-hydroxy-5-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzoate (PubChem CID 19174569) has the molecular formula C20H16BrNO5S2 and a molecular weight of 494.39 g/mol. Its IUPAC name is ethyl 3-[(5E)-5-[(3-bromo-4-hydroxy-5-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzoate.
| Compound Name | ethyl 3-[(5E)-5-[(3-bromo-4-hydroxy-5-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzoate |
|---|---|
| PubChem CID | 19174569 |
| Molecular Formula | C20H16BrNO5S2 |
| Molecular Weight | 494.39 g/mol |
| Exact Mass | 492.97 |
| IUPAC Name | ethyl 3-[(5E)-5-[(3-bromo-4-hydroxy-5-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzoate |
| SMILES | CCOC(=O)c1cccc(N2C(=O)/C(=C\c3cc(Br)c(O)c(OC)c3)SC2=S)c1 |
| InChI | InChI=1S/C20H16BrNO5S2/c1-3-27-19(25)12-5-4-6-13(10-12)22-18(24)16(29-20(22)28)9-11-7-14(21)17(23)15(8-11)26-2/h4-10,23H,3H2,1-2H3/b16-9+ |
| InChIKey | KSRIJEPYYCLHBM-CXUHLZMHSA-N |
| XLogP | 4.75 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.39 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|