C22H22BrNO3S3 — CID 126335169
(5Z)-5-[(3-bromo-5-ethoxy-4-propoxyphenyl)methylidene]-3-(3-methylsulfanylphenyl)-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 126335169) has the molecular formula C22H22BrNO3S3 and a molecular weight of 524.53 g/mol. Its IUPAC name is (5Z)-5-[(3-bromo-5-ethoxy-4-propoxyphenyl)methylidene]-3-(3-methylsulfanylphenyl)-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[(3-bromo-5-ethoxy-4-propoxyphenyl)methylidene]-3-(3-methylsulfanylphenyl)-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126335169 |
| Molecular Formula | C22H22BrNO3S3 |
| Molecular Weight | 524.53 g/mol |
| Exact Mass | 522.99 |
| IUPAC Name | (5Z)-5-[(3-bromo-5-ethoxy-4-propoxyphenyl)methylidene]-3-(3-methylsulfanylphenyl)-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | CCCOc1c(Br)cc(/C=C2\SC(=S)N(c3cccc(SC)c3)C2=O)cc1OCC |
| InChI | InChI=1S/C22H22BrNO3S3/c1-4-9-27-20-17(23)10-14(11-18(20)26-5-2)12-19-21(25)24(22(28)30-19)15-7-6-8-16(13-15)29-3/h6-8,10-13H,4-5,9H2,1-3H3/b19-12- |
| InChIKey | CHAIJTRXBJAILL-UNOMPAQXSA-N |
| XLogP | 6.76 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.53 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|