C20H18BrNO2S3 — CID 126354377
(5Z)-5-[(3-bromo-4-propoxyphenyl)methylidene]-3-(3-methylsulfanylphenyl)-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 126354377) has the molecular formula C20H18BrNO2S3 and a molecular weight of 480.47 g/mol. Its IUPAC name is (5Z)-5-[(3-bromo-4-propoxyphenyl)methylidene]-3-(3-methylsulfanylphenyl)-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[(3-bromo-4-propoxyphenyl)methylidene]-3-(3-methylsulfanylphenyl)-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126354377 |
| Molecular Formula | C20H18BrNO2S3 |
| Molecular Weight | 480.47 g/mol |
| Exact Mass | 478.97 |
| IUPAC Name | (5Z)-5-[(3-bromo-4-propoxyphenyl)methylidene]-3-(3-methylsulfanylphenyl)-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | CCCOc1ccc(/C=C2\SC(=S)N(c3cccc(SC)c3)C2=O)cc1Br |
| InChI | InChI=1S/C20H18BrNO2S3/c1-3-9-24-17-8-7-13(10-16(17)21)11-18-19(23)22(20(25)27-18)14-5-4-6-15(12-14)26-2/h4-8,10-12H,3,9H2,1-2H3/b18-11- |
| InChIKey | OJODHMNSYZEPAZ-WQRHYEAKSA-N |
| XLogP | 6.37 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.47 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|