C25H21NO4S — CID 21377102
(5E)-5-[(4-hydroxy-3-methoxy-5-prop-2-enylphenyl)methylidene]-3-(naphthalen-1-ylmethyl)-1,3-thiazolidine-2,4-dione (PubChem CID 21377102) has the molecular formula C25H21NO4S and a molecular weight of 431.51 g/mol. Its IUPAC name is (5E)-5-[(4-hydroxy-3-methoxy-5-prop-2-enylphenyl)methylidene]-3-(naphthalen-1-ylmethyl)-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[(4-hydroxy-3-methoxy-5-prop-2-enylphenyl)methylidene]-3-(naphthalen-1-ylmethyl)-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 21377102 |
| Molecular Formula | C25H21NO4S |
| Molecular Weight | 431.51 g/mol |
| Exact Mass | 431.12 |
| IUPAC Name | (5E)-5-[(4-hydroxy-3-methoxy-5-prop-2-enylphenyl)methylidene]-3-(naphthalen-1-ylmethyl)-1,3-thiazolidine-2,4-dione |
| SMILES | C=CCc1cc(/C=C2/SC(=O)N(Cc3cccc4ccccc34)C2=O)cc(OC)c1O |
| InChI | InChI=1S/C25H21NO4S/c1-3-7-18-12-16(13-21(30-2)23(18)27)14-22-24(28)26(25(29)31-22)15-19-10-6-9-17-8-4-5-11-20(17)19/h3-6,8-14,27H,1,7,15H2,2H3/b22-14+ |
| InChIKey | YLPWRPFJDVDPMH-HYARGMPZSA-N |
| XLogP | 5.52 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.51 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|