C22H21NO4S — CID 3290712
3-benzyl-5-[(3,4-dimethoxy-5-prop-2-enylphenyl)methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 3290712) has the molecular formula C22H21NO4S and a molecular weight of 395.48 g/mol. Its IUPAC name is 3-benzyl-5-[(3,4-dimethoxy-5-prop-2-enylphenyl)methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | 3-benzyl-5-[(3,4-dimethoxy-5-prop-2-enylphenyl)methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 3290712 |
| Molecular Formula | C22H21NO4S |
| Molecular Weight | 395.48 g/mol |
| Exact Mass | 395.12 |
| IUPAC Name | 3-benzyl-5-[(3,4-dimethoxy-5-prop-2-enylphenyl)methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | C=CCc1cc(C=C2SC(=O)N(Cc3ccccc3)C2=O)cc(OC)c1OC |
| InChI | InChI=1S/C22H21NO4S/c1-4-8-17-11-16(12-18(26-2)20(17)27-3)13-19-21(24)23(22(25)28-19)14-15-9-6-5-7-10-15/h4-7,9-13H,1,8,14H2,2-3H3 |
| InChIKey | OTZQDSGBLAHDJG-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.48 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|