C29H32N2O5S — CID 3689530
3-[2-(azepan-1-yl)-2-oxoethyl]-5-[(3-methoxy-4-phenylmethoxy-5-prop-2-enylphenyl)methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 3689530) has the molecular formula C29H32N2O5S and a molecular weight of 520.65 g/mol. Its IUPAC name is 3-[2-(azepan-1-yl)-2-oxoethyl]-5-[(3-methoxy-4-phenylmethoxy-5-prop-2-enylphenyl)methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | 3-[2-(azepan-1-yl)-2-oxoethyl]-5-[(3-methoxy-4-phenylmethoxy-5-prop-2-enylphenyl)methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 3689530 |
| Molecular Formula | C29H32N2O5S |
| Molecular Weight | 520.65 g/mol |
| Exact Mass | 520.20 |
| IUPAC Name | 3-[2-(azepan-1-yl)-2-oxoethyl]-5-[(3-methoxy-4-phenylmethoxy-5-prop-2-enylphenyl)methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | C=CCc1cc(C=C2SC(=O)N(CC(=O)N3CCCCCC3)C2=O)cc(OC)c1OCc1ccccc1 |
| InChI | InChI=1S/C29H32N2O5S/c1-3-11-23-16-22(17-24(35-2)27(23)36-20-21-12-7-6-8-13-21)18-25-28(33)31(29(34)37-25)19-26(32)30-14-9-4-5-10-15-30/h3,6-8,12-13,16-18H,1,4-5,9-11,14-15,19-20H2,2H3 |
| InChIKey | IYIIZPWXKVSPCB-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.65 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|