C35H35N3O7S — CID 126019522
4-[[4-[(E)-[2,4-dioxo-3-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]-1,3-thiazolidin-5-ylidene]methyl]-2-ethoxy-6-prop-2-enylphenoxy]methyl]benzoic acid (PubChem CID 126019522) has the molecular formula C35H35N3O7S and a molecular weight of 641.75 g/mol. Its IUPAC name is 4-[[4-[(E)-[2,4-dioxo-3-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]-1,3-thiazolidin-5-ylidene]methyl]-2-ethoxy-6-prop-2-enylphenoxy]methyl]benzoic acid.
| Compound Name | 4-[[4-[(E)-[2,4-dioxo-3-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]-1,3-thiazolidin-5-ylidene]methyl]-2-ethoxy-6-prop-2-enylphenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 126019522 |
| Molecular Formula | C35H35N3O7S |
| Molecular Weight | 641.75 g/mol |
| Exact Mass | 641.22 |
| IUPAC Name | 4-[[4-[(E)-[2,4-dioxo-3-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]-1,3-thiazolidin-5-ylidene]methyl]-2-ethoxy-6-prop-2-enylphenoxy]methyl]benzoic acid |
| SMILES | C=CCc1cc(/C=C2/SC(=O)N(CC(=O)N3CCN(c4ccccc4)CC3)C2=O)cc(OCC)c1OCc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C35H35N3O7S/c1-3-8-27-19-25(20-29(44-4-2)32(27)45-23-24-11-13-26(14-12-24)34(41)42)21-30-33(40)38(35(43)46-30)22-31(39)37-17-15-36(16-18-37)28-9-6-5-7-10-28/h3,5-7,9-14,19-21H,1,4,8,15-18,22-23H2,2H3,(H,41,42)/b30-21+ |
| InChIKey | LPXPLBYUYGUNIC-MWAVMZGNSA-N |
| XLogP | 5.48 |
| TPSA | 116.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.75 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|