C26H27NO6S — CID 4316366
4-[[4-[(2,4-dioxo-3-propan-2-yl-1,3-thiazolidin-5-ylidene)methyl]-2-ethoxy-6-prop-2-enylphenoxy]methyl]benzoic acid (PubChem CID 4316366) has the molecular formula C26H27NO6S and a molecular weight of 481.57 g/mol. Its IUPAC name is 4-[[4-[(2,4-dioxo-3-propan-2-yl-1,3-thiazolidin-5-ylidene)methyl]-2-ethoxy-6-prop-2-enylphenoxy]methyl]benzoic acid.
| Compound Name | 4-[[4-[(2,4-dioxo-3-propan-2-yl-1,3-thiazolidin-5-ylidene)methyl]-2-ethoxy-6-prop-2-enylphenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 4316366 |
| Molecular Formula | C26H27NO6S |
| Molecular Weight | 481.57 g/mol |
| Exact Mass | 481.16 |
| IUPAC Name | 4-[[4-[(2,4-dioxo-3-propan-2-yl-1,3-thiazolidin-5-ylidene)methyl]-2-ethoxy-6-prop-2-enylphenoxy]methyl]benzoic acid |
| SMILES | C=CCc1cc(C=C2SC(=O)N(C(C)C)C2=O)cc(OCC)c1OCc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C26H27NO6S/c1-5-7-20-12-18(14-22-24(28)27(16(3)4)26(31)34-22)13-21(32-6-2)23(20)33-15-17-8-10-19(11-9-17)25(29)30/h5,8-14,16H,1,6-7,15H2,2-4H3,(H,29,30) |
| InChIKey | QPTBEKVCOLXCMQ-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.57 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|