C26H23NO6S — CID 126056274
4-[[4-[(E)-(2,4-dioxo-3-prop-2-ynyl-1,3-thiazolidin-5-ylidene)methyl]-2-ethoxy-6-prop-2-enylphenoxy]methyl]benzoic acid (PubChem CID 126056274) has the molecular formula C26H23NO6S and a molecular weight of 477.54 g/mol. Its IUPAC name is 4-[[4-[(E)-(2,4-dioxo-3-prop-2-ynyl-1,3-thiazolidin-5-ylidene)methyl]-2-ethoxy-6-prop-2-enylphenoxy]methyl]benzoic acid.
| Compound Name | 4-[[4-[(E)-(2,4-dioxo-3-prop-2-ynyl-1,3-thiazolidin-5-ylidene)methyl]-2-ethoxy-6-prop-2-enylphenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 126056274 |
| Molecular Formula | C26H23NO6S |
| Molecular Weight | 477.54 g/mol |
| Exact Mass | 477.12 |
| IUPAC Name | 4-[[4-[(E)-(2,4-dioxo-3-prop-2-ynyl-1,3-thiazolidin-5-ylidene)methyl]-2-ethoxy-6-prop-2-enylphenoxy]methyl]benzoic acid |
| SMILES | C#CCN1C(=O)S/C(=C/c2cc(CC=C)c(OCc3ccc(C(=O)O)cc3)c(OCC)c2)C1=O |
| InChI | InChI=1S/C26H23NO6S/c1-4-7-20-13-18(15-22-24(28)27(12-5-2)26(31)34-22)14-21(32-6-3)23(20)33-16-17-8-10-19(11-9-17)25(29)30/h2,4,8-11,13-15H,1,6-7,12,16H2,3H3,(H,29,30)/b22-15+ |
| InChIKey | YFXGNVISFTUKGP-PXLXIMEGSA-N |
| XLogP | 4.76 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.54 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|