C26H29NO5S — CID 126226915
(5E)-5-[(3-ethoxy-4-phenylmethoxy-5-prop-2-enylphenyl)methylidene]-3-(3-methoxypropyl)-1,3-thiazolidine-2,4-dione (PubChem CID 126226915) has the molecular formula C26H29NO5S and a molecular weight of 467.59 g/mol. Its IUPAC name is (5E)-5-[(3-ethoxy-4-phenylmethoxy-5-prop-2-enylphenyl)methylidene]-3-(3-methoxypropyl)-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[(3-ethoxy-4-phenylmethoxy-5-prop-2-enylphenyl)methylidene]-3-(3-methoxypropyl)-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126226915 |
| Molecular Formula | C26H29NO5S |
| Molecular Weight | 467.59 g/mol |
| Exact Mass | 467.18 |
| IUPAC Name | (5E)-5-[(3-ethoxy-4-phenylmethoxy-5-prop-2-enylphenyl)methylidene]-3-(3-methoxypropyl)-1,3-thiazolidine-2,4-dione |
| SMILES | C=CCc1cc(/C=C2/SC(=O)N(CCCOC)C2=O)cc(OCC)c1OCc1ccccc1 |
| InChI | InChI=1S/C26H29NO5S/c1-4-10-21-15-20(17-23-25(28)27(26(29)33-23)13-9-14-30-3)16-22(31-5-2)24(21)32-18-19-11-7-6-8-12-19/h4,6-8,11-12,15-17H,1,5,9-10,13-14,18H2,2-3H3/b23-17+ |
| InChIKey | DVOQVJRBOOFGDS-HAVVHWLPSA-N |
| XLogP | 5.47 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.59 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|